C26H37N7O4 — CID 135095187
(14R)-8,14-dimethyl-20-[(3S)-piperidine-3-carbonyl]-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione (PubChem CID 135095187) has the molecular formula C26H37N7O4 and a molecular weight of 511.63 g/mol. Its IUPAC name is (14R)-8,14-dimethyl-20-[(3S)-piperidine-3-carbonyl]-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione.
| Compound Name | (14R)-8,14-dimethyl-20-[(3S)-piperidine-3-carbonyl]-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
|---|---|
| PubChem CID | 135095187 |
| Molecular Formula | C26H37N7O4 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | (14R)-8,14-dimethyl-20-[(3S)-piperidine-3-carbonyl]-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
| SMILES | Cc1ccc2c(c1)OCCCn1cc(nn1)CN(C(=O)[C@H]1CCCNC1)CCCNC(=O)[C@@H](C)NC2=O |
| InChI | InChI=1S/C26H37N7O4/c1-18-7-8-22-23(14-18)37-13-5-12-33-17-21(30-31-33)16-32(26(36)20-6-3-9-27-15-20)11-4-10-28-24(34)19(2)29-25(22)35/h7-8,14,17,19-20,27H,3-6,9-13,15-16H2,1-2H3,(H,28,34)(H,29,35)/t19-,20+/m1/s1 |
| InChIKey | KCYYJCWIQSQOEL-UXHICEINSA-N |
| XLogP | 1.02 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |