C27H31F3N6O5S — CID 135092593
(14R)-8,14-dimethyl-20-[3-(trifluoromethyl)phenyl]sulfonyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione (PubChem CID 135092593) has the molecular formula C27H31F3N6O5S and a molecular weight of 608.64 g/mol. Its IUPAC name is (14R)-8,14-dimethyl-20-[3-(trifluoromethyl)phenyl]sulfonyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione.
| Compound Name | (14R)-8,14-dimethyl-20-[3-(trifluoromethyl)phenyl]sulfonyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
|---|---|
| PubChem CID | 135092593 |
| Molecular Formula | C27H31F3N6O5S |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | (14R)-8,14-dimethyl-20-[3-(trifluoromethyl)phenyl]sulfonyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
| SMILES | Cc1ccc2c(c1)OCCCn1cc(nn1)CN(S(=O)(=O)c1cccc(C(F)(F)F)c1)CCCNC(=O)[C@@H](C)NC2=O |
| InChI | InChI=1S/C27H31F3N6O5S/c1-18-8-9-23-24(14-18)41-13-5-11-35-16-21(33-34-35)17-36(12-4-10-31-25(37)19(2)32-26(23)38)42(39,40)22-7-3-6-20(15-22)27(28,29)30/h3,6-9,14-16,19H,4-5,10-13,17H2,1-2H3,(H,31,37)(H,32,38)/t19-/m1/s1 |
| InChIKey | DHNCEESNIYONTL-LJQANCHMSA-N |
| XLogP | 2.90 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |