C28H32ClFN6O4 — CID 135115704
(14R)-20-[2-(2-chloro-6-fluorophenyl)acetyl]-8,14-dimethyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione (PubChem CID 135115704) has the molecular formula C28H32ClFN6O4 and a molecular weight of 571.05 g/mol. Its IUPAC name is (14R)-20-[2-(2-chloro-6-fluorophenyl)acetyl]-8,14-dimethyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione.
| Compound Name | (14R)-20-[2-(2-chloro-6-fluorophenyl)acetyl]-8,14-dimethyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
|---|---|
| PubChem CID | 135115704 |
| Molecular Formula | C28H32ClFN6O4 |
| Molecular Weight | 571.05 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | (14R)-20-[2-(2-chloro-6-fluorophenyl)acetyl]-8,14-dimethyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
| SMILES | Cc1ccc2c(c1)OCCCn1cc(nn1)CN(C(=O)Cc1c(F)cccc1Cl)CCCNC(=O)[C@@H](C)NC2=O |
| InChI | InChI=1S/C28H32ClFN6O4/c1-18-8-9-21-25(14-18)40-13-5-12-36-17-20(33-34-36)16-35(11-4-10-31-27(38)19(2)32-28(21)39)26(37)15-22-23(29)6-3-7-24(22)30/h3,6-9,14,17,19H,4-5,10-13,15-16H2,1-2H3,(H,31,38)(H,32,39)/t19-/m1/s1 |
| InChIKey | BMFKFSFUCXCWIC-LJQANCHMSA-N |
| XLogP | 3.06 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.05 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |