C32H37N7O4 — CID 135118315
(14R)-20-(2,8-dimethylquinoline-3-carbonyl)-8,14-dimethyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione (PubChem CID 135118315) has the molecular formula C32H37N7O4 and a molecular weight of 583.69 g/mol. Its IUPAC name is (14R)-20-(2,8-dimethylquinoline-3-carbonyl)-8,14-dimethyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione.
| Compound Name | (14R)-20-(2,8-dimethylquinoline-3-carbonyl)-8,14-dimethyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
|---|---|
| PubChem CID | 135118315 |
| Molecular Formula | C32H37N7O4 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | (14R)-20-(2,8-dimethylquinoline-3-carbonyl)-8,14-dimethyl-5-oxa-1,13,16,20,23,24-hexazatricyclo[20.2.1.06,11]pentacosa-6(11),7,9,22(25),23-pentaene-12,15-dione |
| SMILES | Cc1ccc2c(c1)OCCCn1cc(nn1)CN(C(=O)c1cc3cccc(C)c3nc1C)CCCNC(=O)[C@@H](C)NC2=O |
| InChI | InChI=1S/C32H37N7O4/c1-20-10-11-26-28(16-20)43-15-7-14-39-19-25(36-37-39)18-38(13-6-12-33-30(40)23(4)35-31(26)41)32(42)27-17-24-9-5-8-21(2)29(24)34-22(27)3/h5,8-11,16-17,19,23H,6-7,12-15,18H2,1-4H3,(H,33,40)(H,35,41)/t23-/m1/s1 |
| InChIKey | YKWLERQOCNXZBE-HSZRJFAPSA-N |
| XLogP | 3.50 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |