C20H27N3O — CID 135096338
[(4aS,8aS)-1-methyl-7-(2-methylquinolin-4-yl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135096338) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is [(4aS,8aS)-1-methyl-7-(2-methylquinolin-4-yl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-1-methyl-7-(2-methylquinolin-4-yl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135096338 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | [(4aS,8aS)-1-methyl-7-(2-methylquinolin-4-yl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | Cc1cc(N2CC[C@@]3(CO)CCCN(C)[C@@H]3C2)c2ccccc2n1 |
| InChI | InChI=1S/C20H27N3O/c1-15-12-18(16-6-3-4-7-17(16)21-15)23-11-9-20(14-24)8-5-10-22(2)19(20)13-23/h3-4,6-7,12,19,24H,5,8-11,13-14H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | WGCJYPGMNBJIGN-WOJBJXKFSA-N |
| XLogP | 2.83 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |