C21H25N5O2 — CID 135096444
1-[2-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrimidin-4-yl]piperidin-3-ol (PubChem CID 135096444) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[2-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrimidin-4-yl]piperidin-3-ol.
| Compound Name | 1-[2-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrimidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 135096444 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-[2-(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)pyrimidin-4-yl]piperidin-3-ol |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(c1nccc(N2CCCC(O)C2)n1)CC3 |
| InChI | InChI=1S/C21H25N5O2/c1-28-15-4-5-18-16(11-15)17-13-26(10-7-19(17)23-18)21-22-8-6-20(24-21)25-9-2-3-14(27)12-25/h4-6,8,11,14,23,27H,2-3,7,9-10,12-13H2,1H3 |
| InChIKey | ILDOJYJZMOXHEN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|