C18H18N6O — CID 163307818
8-methoxy-2-(9-methylpurin-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 163307818) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is 8-methoxy-2-(9-methylpurin-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-methoxy-2-(9-methylpurin-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 163307818 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 8-methoxy-2-(9-methylpurin-2-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(c1ncc2ncn(C)c2n1)CC3 |
| InChI | InChI=1S/C18H18N6O/c1-23-10-20-16-8-19-18(22-17(16)23)24-6-5-15-13(9-24)12-7-11(25-2)3-4-14(12)21-15/h3-4,7-8,10,21H,5-6,9H2,1-2H3 |
| InChIKey | MWMIUVMIDMQBKR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|