C19H18N6O2 — CID 25296773
5-[(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-3-pyrazin-2-yl-1,2,4-oxadiazole (PubChem CID 25296773) has the molecular formula C19H18N6O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 5-[(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-3-pyrazin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-3-pyrazin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 25296773 |
| Molecular Formula | C19H18N6O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 5-[(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methyl]-3-pyrazin-2-yl-1,2,4-oxadiazole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(Cc1nc(-c2cnccn2)no1)CC3 |
| InChI | InChI=1S/C19H18N6O2/c1-26-12-2-3-15-13(8-12)14-10-25(7-4-16(14)22-15)11-18-23-19(24-27-18)17-9-20-5-6-21-17/h2-3,5-6,8-9,22H,4,7,10-11H2,1H3 |
| InChIKey | GSZSZPROWPPFSE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|