C23H27N3O — CID 177310182
2-[3-(2,3-dihydro-1H-indol-7-yl)propyl]-8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 177310182) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1H-indol-7-yl)propyl]-8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-[3-(2,3-dihydro-1H-indol-7-yl)propyl]-8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 177310182 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 2-[3-(2,3-dihydro-1H-indol-7-yl)propyl]-8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(CCCc1cccc2c1NCC2)CC3 |
| InChI | InChI=1S/C23H27N3O/c1-27-18-7-8-21-19(14-18)20-15-26(13-10-22(20)25-21)12-3-6-16-4-2-5-17-9-11-24-23(16)17/h2,4-5,7-8,14,24-25H,3,6,9-13,15H2,1H3 |
| InChIKey | JPHQZNDKLIELMP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|