C21H26N2O4 — CID 135098413
[(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(5-phenoxyfuran-2-yl)methanone (PubChem CID 135098413) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(5-phenoxyfuran-2-yl)methanone.
| Compound Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(5-phenoxyfuran-2-yl)methanone |
|---|---|
| PubChem CID | 135098413 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [(4aS,8aS)-4a-(hydroxymethyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(5-phenoxyfuran-2-yl)methanone |
| SMILES | CN1CCC[C@]2(CO)CCN(C(=O)c3ccc(Oc4ccccc4)o3)C[C@@H]12 |
| InChI | InChI=1S/C21H26N2O4/c1-22-12-5-10-21(15-24)11-13-23(14-18(21)22)20(25)17-8-9-19(27-17)26-16-6-3-2-4-7-16/h2-4,6-9,18,24H,5,10-15H2,1H3/t18-,21-/m1/s1 |
| InChIKey | PRWQOLLOLBFWRW-WIYYLYMNSA-N |
| XLogP | 2.99 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |