C26H46N4O3 — CID 135101790
cis-(2R,5R)-2-methyl-5-propan-2-yl-11-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135101790) has the molecular formula C26H46N4O3 and a molecular weight of 462.68 g/mol. Its IUPAC name is cis-(2R,5R)-2-methyl-5-propan-2-yl-11-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | cis-(2R,5R)-2-methyl-5-propan-2-yl-11-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135101790 |
| Molecular Formula | C26H46N4O3 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.36 |
| IUPAC Name | cis-(2R,5R)-2-methyl-5-propan-2-yl-11-[2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | CC1=C(CCN2CCCNC(=O)[C@@H](C(C)C)NC(=O)[C@@H](C)NC(=O)CCC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C26H46N4O3/c1-18(2)23-25(33)27-14-9-16-30(15-8-11-22(31)28-20(4)24(32)29-23)17-12-21-19(3)10-7-13-26(21,5)6/h18,20,23H,7-17H2,1-6H3,(H,27,33)(H,28,31)(H,29,32)/t20-,23-/m1/s1 |
| InChIKey | VWYDZUMWIFZUEZ-NFBKMPQASA-N |
| XLogP | 3.15 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|