C14H25N3O3 — CID 123807922
6,6-diethyl-3-methyl-1,4,7-triazacyclododecane-2,5,8-trione (PubChem CID 123807922) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 6,6-diethyl-3-methyl-1,4,7-triazacyclododecane-2,5,8-trione.
| Compound Name | 6,6-diethyl-3-methyl-1,4,7-triazacyclododecane-2,5,8-trione |
|---|---|
| PubChem CID | 123807922 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 6,6-diethyl-3-methyl-1,4,7-triazacyclododecane-2,5,8-trione |
| SMILES | CCC1(CC)NC(=O)CCCCNC(=O)C(C)NC1=O |
| InChI | InChI=1S/C14H25N3O3/c1-4-14(5-2)13(20)16-10(3)12(19)15-9-7-6-8-11(18)17-14/h10H,4-9H2,1-3H3,(H,15,19)(H,16,20)(H,17,18) |
| InChIKey | HEXIXNXLSGUGRD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |