C20H36N4O4 — CID 135108147
cis-(2R,5R)-2-methyl-11-(3-methylbutanoyl)-5-propan-2-yl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135108147) has the molecular formula C20H36N4O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is cis-(2R,5R)-2-methyl-11-(3-methylbutanoyl)-5-propan-2-yl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | cis-(2R,5R)-2-methyl-11-(3-methylbutanoyl)-5-propan-2-yl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135108147 |
| Molecular Formula | C20H36N4O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | cis-(2R,5R)-2-methyl-11-(3-methylbutanoyl)-5-propan-2-yl-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | CC(C)CC(=O)N1CCCNC(=O)[C@@H](C(C)C)NC(=O)[C@@H](C)NC(=O)CCC1 |
| InChI | InChI=1S/C20H36N4O4/c1-13(2)12-17(26)24-10-6-8-16(25)22-15(5)19(27)23-18(14(3)4)20(28)21-9-7-11-24/h13-15,18H,6-12H2,1-5H3,(H,21,28)(H,22,25)(H,23,27)/t15-,18-/m1/s1 |
| InChIKey | IKMCRGKNISANGC-CRAIPNDOSA-N |
| XLogP | 0.81 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |