C15H19ClFNO3S — CID 135101982
(4R,5S)-7-(3-chloro-4-fluorophenyl)sulfonyl-7-azaspiro[4.5]decan-4-ol (PubChem CID 135101982) has the molecular formula C15H19ClFNO3S and a molecular weight of 347.84 g/mol. Its IUPAC name is (4R,5S)-7-(3-chloro-4-fluorophenyl)sulfonyl-7-azaspiro[4.5]decan-4-ol.
| Compound Name | (4R,5S)-7-(3-chloro-4-fluorophenyl)sulfonyl-7-azaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 135101982 |
| Molecular Formula | C15H19ClFNO3S |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (4R,5S)-7-(3-chloro-4-fluorophenyl)sulfonyl-7-azaspiro[4.5]decan-4-ol |
| SMILES | O=S(=O)(c1ccc(F)c(Cl)c1)N1CCC[C@@]2(CCC[C@H]2O)C1 |
| InChI | InChI=1S/C15H19ClFNO3S/c16-12-9-11(4-5-13(12)17)22(20,21)18-8-2-7-15(10-18)6-1-3-14(15)19/h4-5,9,14,19H,1-3,6-8,10H2/t14-,15+/m1/s1 |
| InChIKey | CBNXPVBWKKIUNA-CABCVRRESA-N |
| XLogP | 2.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |