C17H22N4O3 — CID 135102722
(4aR,6R,7aR)-6-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one (PubChem CID 135102722) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (4aR,6R,7aR)-6-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one.
| Compound Name | (4aR,6R,7aR)-6-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 135102722 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (4aR,6R,7aR)-6-[[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
| SMILES | CN1C[C@@H]2C[C@H](N(C)Cc3nc(-c4ccco4)no3)C[C@@H]2CC1=O |
| InChI | InChI=1S/C17H22N4O3/c1-20(10-15-18-17(19-24-15)14-4-3-5-23-14)13-6-11-8-16(22)21(2)9-12(11)7-13/h3-5,11-13H,6-10H2,1-2H3/t11-,12+,13-/m1/s1 |
| InChIKey | GRLHRGBACDYWSO-FRRDWIJNSA-N |
| XLogP | 2.02 |
| TPSA | 75.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |