C32H42ClN5O6 — CID 135113225
(3S,6S,9R,15S)-3-benzyl-13-[2-(3-chloro-4-hydroxyphenyl)acetyl]-15-ethyl-9-methyl-6-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone (PubChem CID 135113225) has the molecular formula C32H42ClN5O6 and a molecular weight of 628.17 g/mol. Its IUPAC name is (3S,6S,9R,15S)-3-benzyl-13-[2-(3-chloro-4-hydroxyphenyl)acetyl]-15-ethyl-9-methyl-6-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9R,15S)-3-benzyl-13-[2-(3-chloro-4-hydroxyphenyl)acetyl]-15-ethyl-9-methyl-6-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 135113225 |
| Molecular Formula | C32H42ClN5O6 |
| Molecular Weight | 628.17 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | (3S,6S,9R,15S)-3-benzyl-13-[2-(3-chloro-4-hydroxyphenyl)acetyl]-15-ethyl-9-methyl-6-(2-methylpropyl)-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@H]1CN(C(=O)Cc2ccc(O)c(Cl)c2)CC(=O)N[C@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C32H42ClN5O6/c1-5-23-17-38(29(41)16-22-11-12-27(39)24(33)14-22)18-28(40)34-20(4)30(42)36-25(13-19(2)3)32(44)37-26(31(43)35-23)15-21-9-7-6-8-10-21/h6-12,14,19-20,23,25-26,39H,5,13,15-18H2,1-4H3,(H,34,40)(H,35,43)(H,36,42)(H,37,44)/t20-,23+,25+,26+/m1/s1 |
| InChIKey | SHRYXYKJVXKESH-UFOFSCLASA-N |
| XLogP | 2.09 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |