C27H40N4O6 — CID 45485819
6-[(2S,5S,8S,11S)-8-benzyl-2-methyl-11-(2-methylpropyl)-3,6,9,13-tetraoxo-1,4,7,10-tetrazacyclotridec-5-yl]hexanoic acid (PubChem CID 45485819) has the molecular formula C27H40N4O6 and a molecular weight of 516.64 g/mol. Its IUPAC name is 6-[(2S,5S,8S,11S)-8-benzyl-2-methyl-11-(2-methylpropyl)-3,6,9,13-tetraoxo-1,4,7,10-tetrazacyclotridec-5-yl]hexanoic acid.
| Compound Name | 6-[(2S,5S,8S,11S)-8-benzyl-2-methyl-11-(2-methylpropyl)-3,6,9,13-tetraoxo-1,4,7,10-tetrazacyclotridec-5-yl]hexanoic acid |
|---|---|
| PubChem CID | 45485819 |
| Molecular Formula | C27H40N4O6 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 6-[(2S,5S,8S,11S)-8-benzyl-2-methyl-11-(2-methylpropyl)-3,6,9,13-tetraoxo-1,4,7,10-tetrazacyclotridec-5-yl]hexanoic acid |
| SMILES | CC(C)C[C@H]1CC(=O)N[C@@H](C)C(=O)N[C@@H](CCCCCC(=O)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C27H40N4O6/c1-17(2)14-20-16-23(32)28-18(3)25(35)30-21(12-8-5-9-13-24(33)34)26(36)31-22(27(37)29-20)15-19-10-6-4-7-11-19/h4,6-7,10-11,17-18,20-22H,5,8-9,12-16H2,1-3H3,(H,28,32)(H,29,37)(H,30,35)(H,31,36)(H,33,34)/t18-,20-,21-,22-/m0/s1 |
| InChIKey | CMOKNQDOFXAZIY-QESAQDPVSA-N |
| XLogP | 1.67 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|