C28H35N3O5S — CID 135117891
(1R,17R,18S)-12-(5-acetylthiophene-2-carbonyl)-5-methoxy-7-oxa-12,15,22-triazatetracyclo[15.5.1.12,6.018,22]tetracosa-2(24),3,5-trien-14-one (PubChem CID 135117891) has the molecular formula C28H35N3O5S and a molecular weight of 525.67 g/mol. Its IUPAC name is (1R,17R,18S)-12-(5-acetylthiophene-2-carbonyl)-5-methoxy-7-oxa-12,15,22-triazatetracyclo[15.5.1.12,6.018,22]tetracosa-2(24),3,5-trien-14-one.
| Compound Name | (1R,17R,18S)-12-(5-acetylthiophene-2-carbonyl)-5-methoxy-7-oxa-12,15,22-triazatetracyclo[15.5.1.12,6.018,22]tetracosa-2(24),3,5-trien-14-one |
|---|---|
| PubChem CID | 135117891 |
| Molecular Formula | C28H35N3O5S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | (1R,17R,18S)-12-(5-acetylthiophene-2-carbonyl)-5-methoxy-7-oxa-12,15,22-triazatetracyclo[15.5.1.12,6.018,22]tetracosa-2(24),3,5-trien-14-one |
| SMILES | COc1ccc2cc1OCCCCN(C(=O)c1ccc(C(C)=O)s1)CC(=O)NC[C@H]1C[C@H]2N2CCC[C@@H]12 |
| InChI | InChI=1S/C28H35N3O5S/c1-18(32)25-9-10-26(37-25)28(34)30-11-3-4-13-36-24-15-19(7-8-23(24)35-2)22-14-20(16-29-27(33)17-30)21-6-5-12-31(21)22/h7-10,15,20-22H,3-6,11-14,16-17H2,1-2H3,(H,29,33)/t20-,21+,22-/m1/s1 |
| InChIKey | GWUHWULPQUQWBZ-BHIFYINESA-N |
| XLogP | 3.92 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |