C30H33N3O6S — CID 137340390
24-methoxy-17-(2-thiophen-2-ylacetyl)-11,22-dioxa-5,14,17-triazatetracyclo[21.3.1.16,10.02,7]octacosa-1(27),6,8,10(28),23,25-hexaene-4,15-dione (PubChem CID 137340390) has the molecular formula C30H33N3O6S and a molecular weight of 563.68 g/mol. Its IUPAC name is 24-methoxy-17-(2-thiophen-2-ylacetyl)-11,22-dioxa-5,14,17-triazatetracyclo[21.3.1.16,10.02,7]octacosa-1(27),6,8,10(28),23,25-hexaene-4,15-dione.
| Compound Name | 24-methoxy-17-(2-thiophen-2-ylacetyl)-11,22-dioxa-5,14,17-triazatetracyclo[21.3.1.16,10.02,7]octacosa-1(27),6,8,10(28),23,25-hexaene-4,15-dione |
|---|---|
| PubChem CID | 137340390 |
| Molecular Formula | C30H33N3O6S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 24-methoxy-17-(2-thiophen-2-ylacetyl)-11,22-dioxa-5,14,17-triazatetracyclo[21.3.1.16,10.02,7]octacosa-1(27),6,8,10(28),23,25-hexaene-4,15-dione |
| SMILES | COc1ccc2cc1OCCCCN(C(=O)Cc1cccs1)CC(=O)NCCOc1ccc3c(c1)NC(=O)CC23 |
| InChI | InChI=1S/C30H33N3O6S/c1-37-26-9-6-20-15-27(26)39-12-3-2-11-33(30(36)17-22-5-4-14-40-22)19-29(35)31-10-13-38-21-7-8-23-24(20)18-28(34)32-25(23)16-21/h4-9,14-16,24H,2-3,10-13,17-19H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | ZJFTVHYIECXPEV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|