C30H33N5O8 — CID 137341004
17-(1,3-dimethyl-2,6-dioxopyrimidine-4-carbonyl)-23-methoxy-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione (PubChem CID 137341004) has the molecular formula C30H33N5O8 and a molecular weight of 591.62 g/mol. Its IUPAC name is 17-(1,3-dimethyl-2,6-dioxopyrimidine-4-carbonyl)-23-methoxy-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione.
| Compound Name | 17-(1,3-dimethyl-2,6-dioxopyrimidine-4-carbonyl)-23-methoxy-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione |
|---|---|
| PubChem CID | 137341004 |
| Molecular Formula | C30H33N5O8 |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 17-(1,3-dimethyl-2,6-dioxopyrimidine-4-carbonyl)-23-methoxy-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione |
| SMILES | COc1ccc2cc1OCCCN(C(=O)c1cc(=O)n(C)c(=O)n1C)CC(=O)NCCOc1ccc3c(c1)NC(=O)CC23 |
| InChI | InChI=1S/C30H33N5O8/c1-33-23(16-28(38)34(2)30(33)40)29(39)35-10-4-11-43-25-13-18(5-8-24(25)41-3)21-15-26(36)32-22-14-19(6-7-20(21)22)42-12-9-31-27(37)17-35/h5-8,13-14,16,21H,4,9-12,15,17H2,1-3H3,(H,31,37)(H,32,36) |
| InChIKey | FDRVZFQTVZKHHH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|