C29H30N4O6 — CID 137343175
23-methoxy-17-(pyridine-4-carbonyl)-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione (PubChem CID 137343175) has the molecular formula C29H30N4O6 and a molecular weight of 530.58 g/mol. Its IUPAC name is 23-methoxy-17-(pyridine-4-carbonyl)-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione.
| Compound Name | 23-methoxy-17-(pyridine-4-carbonyl)-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione |
|---|---|
| PubChem CID | 137343175 |
| Molecular Formula | C29H30N4O6 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 23-methoxy-17-(pyridine-4-carbonyl)-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione |
| SMILES | COc1ccc2cc1OCCCN(C(=O)c1ccncc1)CC(=O)NCCOc1ccc3c(c1)NC(=O)CC23 |
| InChI | InChI=1S/C29H30N4O6/c1-37-25-6-3-20-15-26(25)39-13-2-12-33(29(36)19-7-9-30-10-8-19)18-28(35)31-11-14-38-21-4-5-22-23(20)17-27(34)32-24(22)16-21/h3-10,15-16,23H,2,11-14,17-18H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | VVICCQOWMWTBJS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|