C33H35N3O8 — CID 137342178
17-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-24-methoxy-11,22-dioxa-5,14,17-triazatetracyclo[21.3.1.16,10.02,7]octacosa-1(27),6,8,10(28),23,25-hexaene-4,15-dione (PubChem CID 137342178) has the molecular formula C33H35N3O8 and a molecular weight of 601.66 g/mol. Its IUPAC name is 17-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-24-methoxy-11,22-dioxa-5,14,17-triazatetracyclo[21.3.1.16,10.02,7]octacosa-1(27),6,8,10(28),23,25-hexaene-4,15-dione.
| Compound Name | 17-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-24-methoxy-11,22-dioxa-5,14,17-triazatetracyclo[21.3.1.16,10.02,7]octacosa-1(27),6,8,10(28),23,25-hexaene-4,15-dione |
|---|---|
| PubChem CID | 137342178 |
| Molecular Formula | C33H35N3O8 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 17-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-24-methoxy-11,22-dioxa-5,14,17-triazatetracyclo[21.3.1.16,10.02,7]octacosa-1(27),6,8,10(28),23,25-hexaene-4,15-dione |
| SMILES | COc1ccc2cc1OCCCCN(C(=O)c1cccc3c1OCCO3)CC(=O)NCCOc1ccc3c(c1)NC(=O)CC23 |
| InChI | InChI=1S/C33H35N3O8/c1-40-27-10-7-21-17-29(27)42-13-3-2-12-36(33(39)24-5-4-6-28-32(24)44-16-15-43-28)20-31(38)34-11-14-41-22-8-9-23-25(21)19-30(37)35-26(23)18-22/h4-10,17-18,25H,2-3,11-16,19-20H2,1H3,(H,34,38)(H,35,37) |
| InChIKey | MEUPUOZOTAAEEL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|