C27H32N2O5 — CID 146043312
12-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-16-oxa-9,12-diazatricyclo[15.3.1.04,9]henicosa-1(21),17,19-trien-10-one (PubChem CID 146043312) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is 12-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-16-oxa-9,12-diazatricyclo[15.3.1.04,9]henicosa-1(21),17,19-trien-10-one.
| Compound Name | 12-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-16-oxa-9,12-diazatricyclo[15.3.1.04,9]henicosa-1(21),17,19-trien-10-one |
|---|---|
| PubChem CID | 146043312 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 12-(2,3-dihydro-1,4-benzodioxine-5-carbonyl)-16-oxa-9,12-diazatricyclo[15.3.1.04,9]henicosa-1(21),17,19-trien-10-one |
| SMILES | O=C(c1cccc2c1OCCO2)N1CCCOc2cccc(c2)CCC2CCCCN2C(=O)C1 |
| InChI | InChI=1S/C27H32N2O5/c30-25-19-28(27(31)23-9-4-10-24-26(23)34-17-16-33-24)13-5-15-32-22-8-3-6-20(18-22)11-12-21-7-1-2-14-29(21)25/h3-4,6,8-10,18,21H,1-2,5,7,11-17,19H2 |
| InChIKey | SUZHUKVTDORIED-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |