C29H32ClN5O6 — CID 137343459
17-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-23-methoxy-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione (PubChem CID 137343459) has the molecular formula C29H32ClN5O6 and a molecular weight of 582.06 g/mol. Its IUPAC name is 17-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-23-methoxy-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione.
| Compound Name | 17-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-23-methoxy-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione |
|---|---|
| PubChem CID | 137343459 |
| Molecular Formula | C29H32ClN5O6 |
| Molecular Weight | 582.06 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 17-(4-chloro-1,5-dimethylpyrazole-3-carbonyl)-23-methoxy-11,21-dioxa-5,14,17-triazatetracyclo[20.3.1.16,10.02,7]heptacosa-1(26),6,8,10(27),22,24-hexaene-4,15-dione |
| SMILES | COc1ccc2cc1OCCCN(C(=O)c1nn(C)c(C)c1Cl)CC(=O)NCCOc1ccc3c(c1)NC(=O)CC23 |
| InChI | InChI=1S/C29H32ClN5O6/c1-17-27(30)28(33-34(17)2)29(38)35-10-4-11-41-24-13-18(5-8-23(24)39-3)21-15-25(36)32-22-14-19(6-7-20(21)22)40-12-9-31-26(37)16-35/h5-8,13-14,21H,4,9-12,15-16H2,1-3H3,(H,31,37)(H,32,36) |
| InChIKey | AUDUCWJVNFSOBO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.06 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|