C18H28FN5O2 — CID 135119629
[(4aS,8aS)-7-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol (PubChem CID 135119629) has the molecular formula C18H28FN5O2 and a molecular weight of 365.45 g/mol. Its IUPAC name is [(4aS,8aS)-7-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol.
| Compound Name | [(4aS,8aS)-7-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
|---|---|
| PubChem CID | 135119629 |
| Molecular Formula | C18H28FN5O2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | [(4aS,8aS)-7-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-4a-yl]methanol |
| SMILES | CN1CCC[C@]2(CO)CCN(c3ncc(F)c(N4CCOCC4)n3)C[C@@H]12 |
| InChI | InChI=1S/C18H28FN5O2/c1-22-5-2-3-18(13-25)4-6-24(12-15(18)22)17-20-11-14(19)16(21-17)23-7-9-26-10-8-23/h11,15,25H,2-10,12-13H2,1H3/t15-,18-/m1/s1 |
| InChIKey | FCLKQQUCZDWMSW-CRAIPNDOSA-N |
| XLogP | 0.74 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |