C20H25BrF3N3O5 — CID 135124661
ditert-butyl 2-amino-4-(6-bromo-3-fluoro-2-pyridinyl)-5,5-difluoro-4-methyl-1,3-oxazine-6,6-dicarboxylate (PubChem CID 135124661) has the molecular formula C20H25BrF3N3O5 and a molecular weight of 524.33 g/mol. Its IUPAC name is ditert-butyl 2-amino-4-(6-bromo-3-fluoro-2-pyridinyl)-5,5-difluoro-4-methyl-1,3-oxazine-6,6-dicarboxylate.
| Compound Name | ditert-butyl 2-amino-4-(6-bromo-3-fluoro-2-pyridinyl)-5,5-difluoro-4-methyl-1,3-oxazine-6,6-dicarboxylate |
|---|---|
| PubChem CID | 135124661 |
| Molecular Formula | C20H25BrF3N3O5 |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | ditert-butyl 2-amino-4-(6-bromo-3-fluoro-2-pyridinyl)-5,5-difluoro-4-methyl-1,3-oxazine-6,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)OC(C)(C)C)OC(N)=NC(C)(c2nc(Br)ccc2F)C1(F)F |
| InChI | InChI=1S/C20H25BrF3N3O5/c1-16(2,3)30-13(28)19(14(29)31-17(4,5)6)20(23,24)18(7,27-15(25)32-19)12-10(22)8-9-11(21)26-12/h8-9H,1-7H3,(H2,25,27) |
| InChIKey | RKDBPZYFSFRLNA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|