C19H28BrFN5O3S- — CID 118687985
CID 118687985 (PubChem CID 118687985) has the molecular formula C19H28BrFN5O3S- and a molecular weight of 505.43 g/mol.
| Compound Name | CID 118687985 |
|---|---|
| PubChem CID | 118687985 |
| Molecular Formula | C19H28BrFN5O3S- |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | — |
| SMILES | CN1CCCC/N=[S-](=O)\C[C@@](C)(c2nc(Br)ccc2F)/N=C\1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28BrFN5O3S/c1-18(2,3)29-17(27)24-16-25-19(4,15-13(21)8-9-14(20)23-15)12-30(28)22-10-6-7-11-26(16)5/h8-9H,6-7,10-12H2,1-5H3,(H,24,25,27)/q-1/t19-/m0/s1 |
| InChIKey | LPHKIDUTLKKXMA-IBGZPJMESA-N |
| XLogP | 3.95 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|