C18H26BrF2N5O2S — CID 137446757
tert-butyl N-[C-[1-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-1λ4-thia-2,7-diazacyclohept-7-en-2-yl]-N-(2-fluoroethyl)carbonimidoyl]carbamate (PubChem CID 137446757) has the molecular formula C18H26BrF2N5O2S and a molecular weight of 494.41 g/mol. Its IUPAC name is tert-butyl N-[C-[1-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-1λ4-thia-2,7-diazacyclohept-7-en-2-yl]-N-(2-fluoroethyl)carbonimidoyl]carbamate.
| Compound Name | tert-butyl N-[C-[1-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-1λ4-thia-2,7-diazacyclohept-7-en-2-yl]-N-(2-fluoroethyl)carbonimidoyl]carbamate |
|---|---|
| PubChem CID | 137446757 |
| Molecular Formula | C18H26BrF2N5O2S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | tert-butyl N-[C-[1-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-1λ4-thia-2,7-diazacyclohept-7-en-2-yl]-N-(2-fluoroethyl)carbonimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=N\CCF)N1CCCCN=S1Cc1nc(Br)ccc1F |
| InChI | InChI=1S/C18H26BrF2N5O2S/c1-18(2,3)28-17(27)25-16(22-10-8-20)26-11-5-4-9-23-29(26)12-14-13(21)6-7-15(19)24-14/h6-7H,4-5,8-12H2,1-3H3,(H,22,25,27) |
| InChIKey | LJDJQQCLSVUNSO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|