C12H15N3 — CID 135127908
N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]pyridine-3-carboximidamide (PubChem CID 135127908) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]pyridine-3-carboximidamide.
| Compound Name | N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 135127908 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N'-methyl-N-[(2E)-penta-2,4-dien-2-yl]pyridine-3-carboximidamide |
| SMILES | C=C/C=C(\C)N/C(=N\C)c1cccnc1 |
| InChI | InChI=1S/C12H15N3/c1-4-6-10(2)15-12(13-3)11-7-5-8-14-9-11/h4-9H,1H2,2-3H3,(H,13,15)/b10-6+ |
| InChIKey | DAYZRKNGWQYSGP-UXBLZVDNSA-N |
| XLogP | 2.14 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|