C27H27N3O2 — CID 135133207
N-[(2R)-3-hydroxy-3-methyl-1-phenylbutan-2-yl]-2-(3-phenyl-1H-pyrazol-5-yl)benzamide (PubChem CID 135133207) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[(2R)-3-hydroxy-3-methyl-1-phenylbutan-2-yl]-2-(3-phenyl-1H-pyrazol-5-yl)benzamide.
| Compound Name | N-[(2R)-3-hydroxy-3-methyl-1-phenylbutan-2-yl]-2-(3-phenyl-1H-pyrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 135133207 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[(2R)-3-hydroxy-3-methyl-1-phenylbutan-2-yl]-2-(3-phenyl-1H-pyrazol-5-yl)benzamide |
| SMILES | CC(C)(O)[C@@H](Cc1ccccc1)NC(=O)c1ccccc1-c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C27H27N3O2/c1-27(2,32)25(17-19-11-5-3-6-12-19)28-26(31)22-16-10-9-15-21(22)24-18-23(29-30-24)20-13-7-4-8-14-20/h3-16,18,25,32H,17H2,1-2H3,(H,28,31)(H,29,30)/t25-/m1/s1 |
| InChIKey | PZZBGXSETNUKCY-RUZDIDTESA-N |
| XLogP | 4.86 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |