C28H36N3O4+ — CID 135139061
5-[2-[2-[4-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)ethoxy]phenoxy]ethylamino]ethyl]-8-hydroxy-1H-quinolin-2-one (PubChem CID 135139061) has the molecular formula C28H36N3O4+ and a molecular weight of 478.61 g/mol. Its IUPAC name is 5-[2-[2-[4-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)ethoxy]phenoxy]ethylamino]ethyl]-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[2-[2-[4-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)ethoxy]phenoxy]ethylamino]ethyl]-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135139061 |
| Molecular Formula | C28H36N3O4+ |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 5-[2-[2-[4-[2-(1-azoniabicyclo[2.2.2]octan-1-yl)ethoxy]phenoxy]ethylamino]ethyl]-8-hydroxy-1H-quinolin-2-one |
| SMILES | O=c1ccc2c(CCNCCOc3ccc(OCC[N+]45CCC(CC4)CC5)cc3)ccc(O)c2[nH]1 |
| InChI | InChI=1S/C28H35N3O4/c32-26-7-1-22(25-6-8-27(33)30-28(25)26)9-13-29-14-19-34-23-2-4-24(5-3-23)35-20-18-31-15-10-21(11-16-31)12-17-31/h1-8,21,29H,9-20H2,(H-,30,32,33)/p+1 |
| InChIKey | OMTSDQATRYSXND-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|