C18H15F2N5O2 — CID 135142669
N-[[4-(difluoromethoxy)phenyl]methyl]-2-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)acetamide (PubChem CID 135142669) has the molecular formula C18H15F2N5O2 and a molecular weight of 371.35 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-2-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)acetamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)acetamide |
|---|---|
| PubChem CID | 135142669 |
| Molecular Formula | C18H15F2N5O2 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)acetamide |
| SMILES | O=C(Cc1nc2c(cnc3[nH]ccc32)[nH]1)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H15F2N5O2/c19-18(20)27-11-3-1-10(2-4-11)8-22-15(26)7-14-24-13-9-23-17-12(5-6-21-17)16(13)25-14/h1-6,9,18H,7-8H2,(H,21,23)(H,22,26)(H,24,25) |
| InChIKey | DWPAVWNNHZURPI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |