C14H13N7O — CID 135142916
N-(1H-imidazol-2-ylmethyl)-2-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)acetamide (PubChem CID 135142916) has the molecular formula C14H13N7O and a molecular weight of 295.31 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-2-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)acetamide.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-2-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)acetamide |
|---|---|
| PubChem CID | 135142916 |
| Molecular Formula | C14H13N7O |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-2-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)acetamide |
| SMILES | O=C(Cc1nc2c(cnc3[nH]ccc32)[nH]1)NCc1ncc[nH]1 |
| InChI | InChI=1S/C14H13N7O/c22-12(18-7-11-15-3-4-16-11)5-10-20-9-6-19-14-8(1-2-17-14)13(9)21-10/h1-4,6H,5,7H2,(H,15,16)(H,17,19)(H,18,22)(H,20,21) |
| InChIKey | DNXGPNCNCZDYEQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |