C17H12N6O — CID 135142712
4-cyano-N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)benzamide (PubChem CID 135142712) has the molecular formula C17H12N6O and a molecular weight of 316.32 g/mol. Its IUPAC name is 4-cyano-N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)benzamide.
| Compound Name | 4-cyano-N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 135142712 |
| Molecular Formula | C17H12N6O |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 4-cyano-N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)benzamide |
| SMILES | N#Cc1ccc(C(=O)NCc2nc3c(cnc4[nH]ccc43)[nH]2)cc1 |
| InChI | InChI=1S/C17H12N6O/c18-7-10-1-3-11(4-2-10)17(24)21-9-14-22-13-8-20-16-12(5-6-19-16)15(13)23-14/h1-6,8H,9H2,(H,19,20)(H,21,24)(H,22,23) |
| InChIKey | HZAJGSFCRUJMDP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |