C26H32N6O2 — CID 142379941
2-cyclohexylacetonitrile;ethane;phenyl N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)carbamate (PubChem CID 142379941) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-cyclohexylacetonitrile;ethane;phenyl N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)carbamate.
| Compound Name | 2-cyclohexylacetonitrile;ethane;phenyl N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)carbamate |
|---|---|
| PubChem CID | 142379941 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 2-cyclohexylacetonitrile;ethane;phenyl N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)carbamate |
| SMILES | CC.N#CCC1CCCCC1.O=C(NCc1nc2c(cnc3[nH]ccc32)[nH]1)Oc1ccccc1 |
| InChI | InChI=1S/C16H13N5O2.C8H13N.C2H6/c22-16(23-10-4-2-1-3-5-10)19-9-13-20-12-8-18-15-11(6-7-17-15)14(12)21-13;9-7-6-8-4-2-1-3-5-8;1-2/h1-8H,9H2,(H,17,18)(H,19,22)(H,20,21);8H,1-6H2;1-2H3 |
| InChIKey | JVDDOIMBODVMKH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |