C10H9N5O — CID 167174908
N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)formamide (PubChem CID 167174908) has the molecular formula C10H9N5O and a molecular weight of 215.22 g/mol. Its IUPAC name is N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)formamide.
| Compound Name | N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)formamide |
|---|---|
| PubChem CID | 167174908 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-ylmethyl)formamide |
| SMILES | O=CNCc1nc2c(cnc3[nH]ccc32)[nH]1 |
| InChI | InChI=1S/C10H9N5O/c16-5-11-4-8-14-7-3-13-10-6(1-2-12-10)9(7)15-8/h1-3,5H,4H2,(H,11,16)(H,12,13)(H,14,15) |
| InChIKey | YOXHGUXRRRZIGQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|