C13H15FN2O2 — CID 135143258
(2R)-2-ethenyl-N-(3-fluorophenyl)-N-methyl-1,3-oxazolidine-3-carboxamide (PubChem CID 135143258) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is (2R)-2-ethenyl-N-(3-fluorophenyl)-N-methyl-1,3-oxazolidine-3-carboxamide.
| Compound Name | (2R)-2-ethenyl-N-(3-fluorophenyl)-N-methyl-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 135143258 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2R)-2-ethenyl-N-(3-fluorophenyl)-N-methyl-1,3-oxazolidine-3-carboxamide |
| SMILES | C=C[C@H]1OCCN1C(=O)N(C)c1cccc(F)c1 |
| InChI | InChI=1S/C13H15FN2O2/c1-3-12-16(7-8-18-12)13(17)15(2)11-6-4-5-10(14)9-11/h3-6,9,12H,1,7-8H2,2H3/t12-/m1/s1 |
| InChIKey | UYIZHPARKZUWSV-GFCCVEGCSA-N |
| XLogP | 2.23 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|