C30H36N4O — CID 135151596
6-[4-benzyl-3-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazin-1-yl]hexan-3-ol (PubChem CID 135151596) has the molecular formula C30H36N4O and a molecular weight of 468.65 g/mol. Its IUPAC name is 6-[4-benzyl-3-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazin-1-yl]hexan-3-ol.
| Compound Name | 6-[4-benzyl-3-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazin-1-yl]hexan-3-ol |
|---|---|
| PubChem CID | 135151596 |
| Molecular Formula | C30H36N4O |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 6-[4-benzyl-3-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazin-1-yl]hexan-3-ol |
| SMILES | CCC(O)CCCN1CCN(Cc2ccccc2)C(c2ncc(-c3ccc4ccccc4c3)[nH]2)C1 |
| InChI | InChI=1S/C30H36N4O/c1-2-27(35)13-8-16-33-17-18-34(21-23-9-4-3-5-10-23)29(22-33)30-31-20-28(32-30)26-15-14-24-11-6-7-12-25(24)19-26/h3-7,9-12,14-15,19-20,27,29,35H,2,8,13,16-18,21-22H2,1H3,(H,31,32) |
| InChIKey | QLHGILYIHTWWDD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |