C29H34N4O2S — CID 135151624
1-(benzenesulfonyl)-4-hexyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazine (PubChem CID 135151624) has the molecular formula C29H34N4O2S and a molecular weight of 502.68 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-hexyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazine.
| Compound Name | 1-(benzenesulfonyl)-4-hexyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 135151624 |
| Molecular Formula | C29H34N4O2S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 1-(benzenesulfonyl)-4-hexyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazine |
| SMILES | CCCCCCN1CCN(S(=O)(=O)c2ccccc2)C(c2ncc(-c3ccc4ccccc4c3)[nH]2)C1 |
| InChI | InChI=1S/C29H34N4O2S/c1-2-3-4-10-17-32-18-19-33(36(34,35)26-13-6-5-7-14-26)28(22-32)29-30-21-27(31-29)25-16-15-23-11-8-9-12-24(23)20-25/h5-9,11-16,20-21,28H,2-4,10,17-19,22H2,1H3,(H,30,31) |
| InChIKey | CDVFOAVULRLEPY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|