C33H37N5O2 — CID 155796428
1-[4-hexyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazin-1-yl]-2-(5-hydroxy-1H-indol-3-yl)ethanone (PubChem CID 155796428) has the molecular formula C33H37N5O2 and a molecular weight of 535.69 g/mol. Its IUPAC name is 1-[4-hexyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazin-1-yl]-2-(5-hydroxy-1H-indol-3-yl)ethanone.
| Compound Name | 1-[4-hexyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazin-1-yl]-2-(5-hydroxy-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 155796428 |
| Molecular Formula | C33H37N5O2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | 1-[4-hexyl-2-(5-naphthalen-2-yl-1H-imidazol-2-yl)piperazin-1-yl]-2-(5-hydroxy-1H-indol-3-yl)ethanone |
| SMILES | CCCCCCN1CCN(C(=O)Cc2c[nH]c3ccc(O)cc23)C(c2ncc(-c3ccc4ccccc4c3)[nH]2)C1 |
| InChI | InChI=1S/C33H37N5O2/c1-2-3-4-7-14-37-15-16-38(32(40)18-26-20-34-29-13-12-27(39)19-28(26)29)31(22-37)33-35-21-30(36-33)25-11-10-23-8-5-6-9-24(23)17-25/h5-6,8-13,17,19-21,31,34,39H,2-4,7,14-16,18,22H2,1H3,(H,35,36) |
| InChIKey | YOJDSPNCLSNZDT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|