C11H7F4N3OS — CID 135153711
4-(fluoromethyl)-N-[2-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide (PubChem CID 135153711) has the molecular formula C11H7F4N3OS and a molecular weight of 305.26 g/mol. Its IUPAC name is 4-(fluoromethyl)-N-[2-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide.
| Compound Name | 4-(fluoromethyl)-N-[2-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 135153711 |
| Molecular Formula | C11H7F4N3OS |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 4-(fluoromethyl)-N-[2-(trifluoromethyl)phenyl]thiadiazole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)c1snnc1CF |
| InChI | InChI=1S/C11H7F4N3OS/c12-5-8-9(20-18-17-8)10(19)16-7-4-2-1-3-6(7)11(13,14)15/h1-4H,5H2,(H,16,19) |
| InChIKey | ZFWPXMHAWOAPJM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |