C15H15F3N4O4S2 — CID 135159758
ethyl 1-(1,3-thiazol-2-yl)-6-(trifluoromethylsulfinylcarbamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 135159758) has the molecular formula C15H15F3N4O4S2 and a molecular weight of 436.44 g/mol. Its IUPAC name is ethyl 1-(1,3-thiazol-2-yl)-6-(trifluoromethylsulfinylcarbamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl 1-(1,3-thiazol-2-yl)-6-(trifluoromethylsulfinylcarbamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135159758 |
| Molecular Formula | C15H15F3N4O4S2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | ethyl 1-(1,3-thiazol-2-yl)-6-(trifluoromethylsulfinylcarbamoyl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2CC(C(=O)NS(=O)C(F)(F)F)CN2C(c2nccs2)=NC1 |
| InChI | InChI=1S/C15H15F3N4O4S2/c1-2-26-14(24)9-6-20-11(13-19-3-4-27-13)22-7-8(5-10(9)22)12(23)21-28(25)15(16,17)18/h3-4,8H,2,5-7H2,1H3,(H,21,23) |
| InChIKey | CKASTBXMVNVKQO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |