C6H10N2O2S — CID 135170701
3-(2-methoxyethoxy)-5-methyl-1,2,4-thiadiazole (PubChem CID 135170701) has the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-5-methyl-1,2,4-thiadiazole.
| Compound Name | 3-(2-methoxyethoxy)-5-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 135170701 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 3-(2-methoxyethoxy)-5-methyl-1,2,4-thiadiazole |
| SMILES | COCCOc1nsc(C)n1 |
| InChI | InChI=1S/C6H10N2O2S/c1-5-7-6(8-11-5)10-4-3-9-2/h3-4H2,1-2H3 |
| InChIKey | DGTLJUZYFKFKTO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|