C7H12N2OS — CID 155742643
5-methyl-3-(2-methylpropoxy)-1,2,4-thiadiazole (PubChem CID 155742643) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is 5-methyl-3-(2-methylpropoxy)-1,2,4-thiadiazole.
| Compound Name | 5-methyl-3-(2-methylpropoxy)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 155742643 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 5-methyl-3-(2-methylpropoxy)-1,2,4-thiadiazole |
| SMILES | Cc1nc(OCC(C)C)ns1 |
| InChI | InChI=1S/C7H12N2OS/c1-5(2)4-10-7-8-6(3)11-9-7/h5H,4H2,1-3H3 |
| InChIKey | JIWVVEVFTUGVOH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |