C13H16F2O4 — CID 135175435
propyl 3,3-difluoro-2-hydroxy-3-(4-methoxyphenyl)propanoate (PubChem CID 135175435) has the molecular formula C13H16F2O4 and a molecular weight of 274.26 g/mol. Its IUPAC name is propyl 3,3-difluoro-2-hydroxy-3-(4-methoxyphenyl)propanoate.
| Compound Name | propyl 3,3-difluoro-2-hydroxy-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 135175435 |
| Molecular Formula | C13H16F2O4 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | propyl 3,3-difluoro-2-hydroxy-3-(4-methoxyphenyl)propanoate |
| SMILES | CCCOC(=O)C(O)C(F)(F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H16F2O4/c1-3-8-19-12(17)11(16)13(14,15)9-4-6-10(18-2)7-5-9/h4-7,11,16H,3,8H2,1-2H3 |
| InChIKey | XAGHYHPPSVMWOH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |