C23H25N3S — CID 135176801
2-methyl-N-[1-(3-methylphenyl)ethenyl]-6-(thian-4-yl)quinazolin-4-amine (PubChem CID 135176801) has the molecular formula C23H25N3S and a molecular weight of 375.54 g/mol. Its IUPAC name is 2-methyl-N-[1-(3-methylphenyl)ethenyl]-6-(thian-4-yl)quinazolin-4-amine.
| Compound Name | 2-methyl-N-[1-(3-methylphenyl)ethenyl]-6-(thian-4-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 135176801 |
| Molecular Formula | C23H25N3S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-methyl-N-[1-(3-methylphenyl)ethenyl]-6-(thian-4-yl)quinazolin-4-amine |
| SMILES | C=C(Nc1nc(C)nc2ccc(C3CCSCC3)cc12)c1cccc(C)c1 |
| InChI | InChI=1S/C23H25N3S/c1-15-5-4-6-19(13-15)16(2)24-23-21-14-20(18-9-11-27-12-10-18)7-8-22(21)25-17(3)26-23/h4-8,13-14,18H,2,9-12H2,1,3H3,(H,24,25,26) |
| InChIKey | FEJWRHIUONGGPA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |