About 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid
4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid (PubChem CID 143556675) has the molecular formula C25H34O3
and a molecular weight of 382.54 g/mol. Its IUPAC name is 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid.
Molecular Properties
| Compound Name | 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid |
| PubChem CID | 143556675 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid |
| SMILES | CC.CC(=O)CCc1ccc(C2CCCC2)cc1.Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H20O.C8H8O2.C2H6/c1-12(16)6-7-13-8-10-15(11-9-13)14-4-2-3-5-14;1-6-3-2-4-7(5-6)8(9)10;1-2/h8-11,14H,2-7H2,1H3;2-5H,1H3,(H,9,10);1-2H3 |
| InChIKey | CBQCITXKUPLDOY-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid?
The IUPAC name of 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid (CID 143556675) is 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid.
What is the SMILES notation for 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid?
The canonical SMILES for 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid is CC.CC(=O)CCc1ccc(C2CCCC2)cc1.Cc1cccc(C(=O)O)c1.
What is the InChIKey of 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid?
The InChIKey is CBQCITXKUPLDOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O.C8H8O2.C2H6/c1-12(16)6-7-13-8-10-15(11-9-13)14-4-2-3-5-14;1-6-3-2-4-7(5-6)8(9)10;1-2/h8-11,14H,2-7H2,1H3;2-5H,1H3,(H,9,10);1-2H3.
What are the key properties of 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid?
4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid has a molecular weight of 382.54 g/mol, XLogP of 6.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyclopentylphenyl)butan-2-one;ethane;3-methylbenzoic acid is sourced from PubChem (CID 143556675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).