C24H22Cl2F3N5O4 — CID 135179785
N-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 135179785) has the molecular formula C24H22Cl2F3N5O4 and a molecular weight of 572.37 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135179785 |
| Molecular Formula | C24H22Cl2F3N5O4 |
| Molecular Weight | 572.37 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | N-[(3R,4S)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1COC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(CC(F)(F)F)c2n1 |
| InChI | InChI=1S/C24H22Cl2F3N5O4/c1-4-18(35)32-14-9-38-10-15(14)33-23-30-8-11-5-12(31-13(22(11)34-23)7-24(27,28)29)19-20(25)16(36-2)6-17(37-3)21(19)26/h4-6,8,14-15H,1,7,9-10H2,2-3H3,(H,32,35)(H,30,33,34)/t14-,15+/m0/s1 |
| InChIKey | LLZDKXDEXUSUMI-LSDHHAIUSA-N |
| XLogP | 4.60 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|