C22H22F4N2O2 — CID 135191305
2-[[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methylamino]-5-fluorobenzoic acid (PubChem CID 135191305) has the molecular formula C22H22F4N2O2 and a molecular weight of 422.42 g/mol. Its IUPAC name is 2-[[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methylamino]-5-fluorobenzoic acid.
| Compound Name | 2-[[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methylamino]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 135191305 |
| Molecular Formula | C22H22F4N2O2 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[[(3aS,6aR)-5-[2-(trifluoromethyl)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methylamino]-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1NCN1C[C@H]2CC(c3ccccc3C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C22H22F4N2O2/c23-16-5-6-20(18(9-16)21(29)30)27-12-28-10-14-7-13(8-15(14)11-28)17-3-1-2-4-19(17)22(24,25)26/h1-6,9,13-15,27H,7-8,10-12H2,(H,29,30)/t13?,14-,15+ |
| InChIKey | BHKIGXXQZQHXNX-GOOCMWNKSA-N |
| XLogP | 5.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |