C20H34N2O3 — CID 135194479
tert-butyl (4S)-4-(2-cyano-4,4-dimethyl-3-oxopentyl)-4-methylazepane-1-carboxylate (PubChem CID 135194479) has the molecular formula C20H34N2O3 and a molecular weight of 350.50 g/mol. Its IUPAC name is tert-butyl (4S)-4-(2-cyano-4,4-dimethyl-3-oxopentyl)-4-methylazepane-1-carboxylate.
| Compound Name | tert-butyl (4S)-4-(2-cyano-4,4-dimethyl-3-oxopentyl)-4-methylazepane-1-carboxylate |
|---|---|
| PubChem CID | 135194479 |
| Molecular Formula | C20H34N2O3 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | tert-butyl (4S)-4-(2-cyano-4,4-dimethyl-3-oxopentyl)-4-methylazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@](C)(CC(C#N)C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C20H34N2O3/c1-18(2,3)16(23)15(14-21)13-20(7)9-8-11-22(12-10-20)17(24)25-19(4,5)6/h15H,8-13H2,1-7H3/t15?,20-/m1/s1 |
| InChIKey | CLYDQMLRSDMGPR-YQYDADCPSA-N |
| XLogP | 4.56 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|